C30H37ClN2O3 — CID 166629680
methyl 2-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]-6-methoxybenzoate (PubChem CID 166629680) has the molecular formula C30H37ClN2O3 and a molecular weight of 509.09 g/mol. Its IUPAC name is methyl 2-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]-6-methoxybenzoate.
| Compound Name | methyl 2-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]-6-methoxybenzoate |
|---|---|
| PubChem CID | 166629680 |
| Molecular Formula | C30H37ClN2O3 |
| Molecular Weight | 509.09 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | methyl 2-[8-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]octyl]-6-methoxybenzoate |
| SMILES | COC(=O)c1c(CCCCCCCCNc2c3c(nc4cc(Cl)ccc24)CCCC3)cccc1OC |
| InChI | InChI=1S/C30H37ClN2O3/c1-35-27-16-11-13-21(28(27)30(34)36-2)12-7-5-3-4-6-10-19-32-29-23-14-8-9-15-25(23)33-26-20-22(31)17-18-24(26)29/h11,13,16-18,20H,3-10,12,14-15,19H2,1-2H3,(H,32,33) |
| InChIKey | BVWLKHFEAAHNIO-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.09 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|