C15H22N2O8S — CID 166630235
N-[(2R,3R,4R,5S,6R)-2-ethoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-4-sulfamoylbenzamide (PubChem CID 166630235) has the molecular formula C15H22N2O8S and a molecular weight of 390.41 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-ethoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-4-sulfamoylbenzamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-ethoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 166630235 |
| Molecular Formula | C15H22N2O8S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-ethoxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-4-sulfamoylbenzamide |
| SMILES | CCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H22N2O8S/c1-2-24-15-11(13(20)12(19)10(7-18)25-15)17-14(21)8-3-5-9(6-4-8)26(16,22)23/h3-6,10-13,15,18-20H,2,7H2,1H3,(H,17,21)(H2,16,22,23)/t10-,11-,12-,13-,15-/m1/s1 |
| InChIKey | GURZUWFSGGFJLA-FTQJZPFOSA-N |
| XLogP | -2.09 |
| TPSA | 168.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |