C14H21N3O7S — CID 166632791
N-[[(2R,3S,4R,5R,6R)-5-amino-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl]-4-sulfamoylbenzamide (PubChem CID 166632791) has the molecular formula C14H21N3O7S and a molecular weight of 375.40 g/mol. Its IUPAC name is N-[[(2R,3S,4R,5R,6R)-5-amino-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl]-4-sulfamoylbenzamide.
| Compound Name | N-[[(2R,3S,4R,5R,6R)-5-amino-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 166632791 |
| Molecular Formula | C14H21N3O7S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[[(2R,3S,4R,5R,6R)-5-amino-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl]-4-sulfamoylbenzamide |
| SMILES | CO[C@@H]1O[C@H](CNC(=O)c2ccc(S(N)(=O)=O)cc2)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C14H21N3O7S/c1-23-14-10(15)12(19)11(18)9(24-14)6-17-13(20)7-2-4-8(5-3-7)25(16,21)22/h2-5,9-12,14,18-19H,6,15H2,1H3,(H,17,20)(H2,16,21,22)/t9-,10-,11-,12-,14-/m1/s1 |
| InChIKey | AIJFMSUYFOANCM-CBLPJQPBSA-N |
| XLogP | -2.52 |
| TPSA | 174.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |