C22H26BrClN2 — CID 166632976
N-[(4-bromo-3-chlorophenyl)methyl]-N-[3-(4-methylphenyl)cyclobutyl]pyrrolidin-3-amine (PubChem CID 166632976) has the molecular formula C22H26BrClN2 and a molecular weight of 433.82 g/mol. Its IUPAC name is N-[(4-bromo-3-chlorophenyl)methyl]-N-[3-(4-methylphenyl)cyclobutyl]pyrrolidin-3-amine.
| Compound Name | N-[(4-bromo-3-chlorophenyl)methyl]-N-[3-(4-methylphenyl)cyclobutyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 166632976 |
| Molecular Formula | C22H26BrClN2 |
| Molecular Weight | 433.82 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[(4-bromo-3-chlorophenyl)methyl]-N-[3-(4-methylphenyl)cyclobutyl]pyrrolidin-3-amine |
| SMILES | Cc1ccc(C2CC(N(Cc3ccc(Br)c(Cl)c3)C3CCNC3)C2)cc1 |
| InChI | InChI=1S/C22H26BrClN2/c1-15-2-5-17(6-3-15)18-11-20(12-18)26(19-8-9-25-13-19)14-16-4-7-21(23)22(24)10-16/h2-7,10,18-20,25H,8-9,11-14H2,1H3 |
| InChIKey | GIHNVALVUFCHSG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.82 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |