C24H22N4O6S — CID 166634037
1-[5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-quinolin-5-ylethanone (PubChem CID 166634037) has the molecular formula C24H22N4O6S and a molecular weight of 494.53 g/mol. Its IUPAC name is 1-[5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-quinolin-5-ylethanone.
| Compound Name | 1-[5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-quinolin-5-ylethanone |
|---|---|
| PubChem CID | 166634037 |
| Molecular Formula | C24H22N4O6S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 1-[5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-7-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-quinolin-5-ylethanone |
| SMILES | O=C(C(O)c1cccc2ncccc12)N1CC2=C(C1)CN(S(=O)(=O)c1cnc3c(c1)OCCO3)C2 |
| InChI | InChI=1S/C24H22N4O6S/c29-22(19-3-1-5-20-18(19)4-2-6-25-20)24(30)27-11-15-13-28(14-16(15)12-27)35(31,32)17-9-21-23(26-10-17)34-8-7-33-21/h1-6,9-10,22,29H,7-8,11-14H2 |
| InChIKey | SMTNYZAYBIHAIO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|