C25H37F — CID 166648060
1-fluoro-2-(2,3,3-trimethylbutan-2-yl)-3-[(4Z,6Z)-3,4,8-trimethylnona-1,4,6-trien-2-yl]benzene (PubChem CID 166648060) has the molecular formula C25H37F and a molecular weight of 356.57 g/mol. Its IUPAC name is 1-fluoro-2-(2,3,3-trimethylbutan-2-yl)-3-[(4Z,6Z)-3,4,8-trimethylnona-1,4,6-trien-2-yl]benzene.
| Compound Name | 1-fluoro-2-(2,3,3-trimethylbutan-2-yl)-3-[(4Z,6Z)-3,4,8-trimethylnona-1,4,6-trien-2-yl]benzene |
|---|---|
| PubChem CID | 166648060 |
| Molecular Formula | C25H37F |
| Molecular Weight | 356.57 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 1-fluoro-2-(2,3,3-trimethylbutan-2-yl)-3-[(4Z,6Z)-3,4,8-trimethylnona-1,4,6-trien-2-yl]benzene |
| SMILES | C=C(c1cccc(F)c1C(C)(C)C(C)(C)C)C(C)/C(C)=C\C=C/C(C)C |
| InChI | InChI=1S/C25H37F/c1-17(2)13-11-14-18(3)19(4)20(5)21-15-12-16-22(26)23(21)25(9,10)24(6,7)8/h11-17,19H,5H2,1-4,6-10H3/b13-11-,18-14- |
| InChIKey | KJVSXTBREVIVDJ-NRLBWGGFSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.57 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|