C26H39N — CID 155396040
(2E,4Z)-3,7-dimethyl-2-[1-[3-methyl-2-(2,3,3-trimethylbutan-2-yl)phenyl]ethenyl]octa-2,4,6-trien-1-amine (PubChem CID 155396040) has the molecular formula C26H39N and a molecular weight of 365.61 g/mol. Its IUPAC name is (2E,4Z)-3,7-dimethyl-2-[1-[3-methyl-2-(2,3,3-trimethylbutan-2-yl)phenyl]ethenyl]octa-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z)-3,7-dimethyl-2-[1-[3-methyl-2-(2,3,3-trimethylbutan-2-yl)phenyl]ethenyl]octa-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 155396040 |
| Molecular Formula | C26H39N |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 365.31 |
| IUPAC Name | (2E,4Z)-3,7-dimethyl-2-[1-[3-methyl-2-(2,3,3-trimethylbutan-2-yl)phenyl]ethenyl]octa-2,4,6-trien-1-amine |
| SMILES | C=C(/C(CN)=C(C)\C=C/C=C(C)C)c1cccc(C)c1C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H39N/c1-18(2)13-11-14-19(3)23(17-27)21(5)22-16-12-15-20(4)24(22)26(9,10)25(6,7)8/h11-16H,5,17,27H2,1-4,6-10H3/b14-11-,23-19- |
| InChIKey | OMSIMUBWAAQEFD-WOLXQTQRSA-N |
| XLogP | 7.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|