C19H23N — CID 143722164
N-[(3E,5Z,7Z)-4-methyl-2-(2-methylphenyl)nona-1,3,5,7-tetraen-3-yl]ethanimine (PubChem CID 143722164) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is N-[(3E,5Z,7Z)-4-methyl-2-(2-methylphenyl)nona-1,3,5,7-tetraen-3-yl]ethanimine.
| Compound Name | N-[(3E,5Z,7Z)-4-methyl-2-(2-methylphenyl)nona-1,3,5,7-tetraen-3-yl]ethanimine |
|---|---|
| PubChem CID | 143722164 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-[(3E,5Z,7Z)-4-methyl-2-(2-methylphenyl)nona-1,3,5,7-tetraen-3-yl]ethanimine |
| SMILES | C=C(C(/N=C/C)=C(C)\C=C/C=C\C)c1ccccc1C |
| InChI | InChI=1S/C19H23N/c1-6-8-9-13-16(4)19(20-7-2)17(5)18-14-11-10-12-15(18)3/h6-14H,5H2,1-4H3/b8-6-,13-9-,19-16+,20-7+ |
| InChIKey | CUBDXBLETGORLG-AYPAYCDWSA-N |
| XLogP | 5.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|