C16H17NO4 — CID 166651216
2-(5,6-dihydrofuro[3,2-f][1]benzofuran-3-yl)-N-formylpentanamide (PubChem CID 166651216) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-(5,6-dihydrofuro[3,2-f][1]benzofuran-3-yl)-N-formylpentanamide.
| Compound Name | 2-(5,6-dihydrofuro[3,2-f][1]benzofuran-3-yl)-N-formylpentanamide |
|---|---|
| PubChem CID | 166651216 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-(5,6-dihydrofuro[3,2-f][1]benzofuran-3-yl)-N-formylpentanamide |
| SMILES | CCCC(C(=O)NC=O)c1coc2cc3c(cc12)CCO3 |
| InChI | InChI=1S/C16H17NO4/c1-2-3-11(16(19)17-9-18)13-8-21-15-7-14-10(4-5-20-14)6-12(13)15/h6-9,11H,2-5H2,1H3,(H,17,18,19) |
| InChIKey | QHAAIDBGQILGOA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|