C17H26N2OS — CID 166651440
imino-(4-methylphenyl)-oxo-[(5R)-2,2,5-trimethyl-5-prop-1-en-2-ylpyrrolidin-1-yl]-λ6-sulfane (PubChem CID 166651440) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is imino-(4-methylphenyl)-oxo-[(5R)-2,2,5-trimethyl-5-prop-1-en-2-ylpyrrolidin-1-yl]-λ6-sulfane.
| Compound Name | imino-(4-methylphenyl)-oxo-[(5R)-2,2,5-trimethyl-5-prop-1-en-2-ylpyrrolidin-1-yl]-λ6-sulfane |
|---|---|
| PubChem CID | 166651440 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | imino-(4-methylphenyl)-oxo-[(5R)-2,2,5-trimethyl-5-prop-1-en-2-ylpyrrolidin-1-yl]-λ6-sulfane |
| SMILES | [H]N=S(=O)(c1ccc(C)cc1)N1C(C)(C)CC[C@]1(C)C(=C)C |
| InChI | InChI=1S/C17H26N2OS/c1-13(2)17(6)12-11-16(4,5)19(17)21(18,20)15-9-7-14(3)8-10-15/h7-10,18H,1,11-12H2,2-6H3/t17-,21?/m1/s1 |
| InChIKey | SXGJQULMVJMJRV-OQHSHRKDSA-N |
| XLogP | 4.52 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|