C14H15FN2O4 — CID 166651827
[(E)-(4-fluoro-2-methoxyphenyl)methylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 166651827) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is [(E)-(4-fluoro-2-methoxyphenyl)methylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | [(E)-(4-fluoro-2-methoxyphenyl)methylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 166651827 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [(E)-(4-fluoro-2-methoxyphenyl)methylideneamino] 3,5-dimethyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | COc1cc(F)ccc1/C=N/OC(=O)C1(C)CC(C)=NO1 |
| InChI | InChI=1S/C14H15FN2O4/c1-9-7-14(2,21-17-9)13(18)20-16-8-10-4-5-11(15)6-12(10)19-3/h4-6,8H,7H2,1-3H3/b16-8+ |
| InChIKey | DPBXKOUYYRMNEU-LZYBPNLTSA-N |
| XLogP | 2.27 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|