About 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid
6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid (PubChem CID 166652046) has the molecular formula C9H18O5S
and a molecular weight of 238.30 g/mol. Its IUPAC name is 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid.
Molecular Properties
| Compound Name | 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid |
| PubChem CID | 166652046 |
| Molecular Formula | C9H18O5S |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid |
| SMILES | CC(S)(C(=O)O)C(CO)CC(CO)CO |
| InChI | InChI=1S/C9H18O5S/c1-9(15,8(13)14)7(5-12)2-6(3-10)4-11/h6-7,10-12,15H,2-5H2,1H3,(H,13,14) |
| InChIKey | MULGAOSYABMSHM-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid?
The IUPAC name of 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid (CID 166652046) is 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid.
What is the SMILES notation for 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid?
The canonical SMILES for 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid is CC(S)(C(=O)O)C(CO)CC(CO)CO.
What is the InChIKey of 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid?
The InChIKey is MULGAOSYABMSHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O5S/c1-9(15,8(13)14)7(5-12)2-6(3-10)4-11/h6-7,10-12,15H,2-5H2,1H3,(H,13,14).
What are the key properties of 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid?
6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid has a molecular weight of 238.30 g/mol, XLogP of -0.64, 7 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid is sourced from PubChem (CID 166652046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).