C9H18O5S — CID 166652046
6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid (PubChem CID 166652046) has the molecular formula C9H18O5S and a molecular weight of 238.30 g/mol. Its IUPAC name is 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid.
| Compound Name | 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid |
|---|---|
| PubChem CID | 166652046 |
| Molecular Formula | C9H18O5S |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 6-hydroxy-3,5-bis(hydroxymethyl)-2-methyl-2-sulfanylhexanoic acid |
| SMILES | CC(S)(C(=O)O)C(CO)CC(CO)CO |
| InChI | InChI=1S/C9H18O5S/c1-9(15,8(13)14)7(5-12)2-6(3-10)4-11/h6-7,10-12,15H,2-5H2,1H3,(H,13,14) |
| InChIKey | MULGAOSYABMSHM-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|