C10H21NO4 — CID 175971387
2-amino-5-hydroxy-3-(2-hydroxypropyl)-2-methylhexanoic acid (PubChem CID 175971387) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-amino-5-hydroxy-3-(2-hydroxypropyl)-2-methylhexanoic acid.
| Compound Name | 2-amino-5-hydroxy-3-(2-hydroxypropyl)-2-methylhexanoic acid |
|---|---|
| PubChem CID | 175971387 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-amino-5-hydroxy-3-(2-hydroxypropyl)-2-methylhexanoic acid |
| SMILES | CC(O)CC(CC(C)O)C(C)(N)C(=O)O |
| InChI | InChI=1S/C10H21NO4/c1-6(12)4-8(5-7(2)13)10(3,11)9(14)15/h6-8,12-13H,4-5,11H2,1-3H3,(H,14,15) |
| InChIKey | SOYPTOBKBAIOBN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |