About 2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid
2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid (PubChem CID 22902522) has the molecular formula C10H21NO6
and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid.
Analyze 2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid?
The IUPAC name of 2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid (CID 22902522) is 2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid.
What is the SMILES notation for 2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid?
The canonical SMILES for 2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid is CC(C)(C(=O)O)N(C(CO)CO)C(CO)CO.
What is the InChIKey of 2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid?
The InChIKey is XIAVOPXLARZNGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO6/c1-10(2,9(16)17)11(7(3-12)4-13)8(5-14)6-15/h7-8,12-15H,3-6H2,1-2H3,(H,16,17).
What are the key properties of 2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid?
2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid has a molecular weight of 251.28 g/mol, XLogP of -2.14, 8 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(1,3-dihydroxypropan-2-yl)amino]-2-methylpropanoic acid is sourced from PubChem (CID 22902522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).