C14H29FN2O — CID 166654405
6-[2-(1-fluoroethenylamino)ethoxy]-3,3,6-trimethylheptan-1-amine (PubChem CID 166654405) has the molecular formula C14H29FN2O and a molecular weight of 260.40 g/mol. Its IUPAC name is 6-[2-(1-fluoroethenylamino)ethoxy]-3,3,6-trimethylheptan-1-amine.
| Compound Name | 6-[2-(1-fluoroethenylamino)ethoxy]-3,3,6-trimethylheptan-1-amine |
|---|---|
| PubChem CID | 166654405 |
| Molecular Formula | C14H29FN2O |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 6-[2-(1-fluoroethenylamino)ethoxy]-3,3,6-trimethylheptan-1-amine |
| SMILES | C=C(F)NCCOC(C)(C)CCC(C)(C)CCN |
| InChI | InChI=1S/C14H29FN2O/c1-12(15)17-10-11-18-14(4,5)7-6-13(2,3)8-9-16/h17H,1,6-11,16H2,2-5H3 |
| InChIKey | SVPCFERYJOYVID-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|