C20H43NO2 — CID 146180137
N-tert-butyl-3,3,6-trimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]heptan-1-amine (PubChem CID 146180137) has the molecular formula C20H43NO2 and a molecular weight of 329.57 g/mol. Its IUPAC name is N-tert-butyl-3,3,6-trimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]heptan-1-amine.
| Compound Name | N-tert-butyl-3,3,6-trimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]heptan-1-amine |
|---|---|
| PubChem CID | 146180137 |
| Molecular Formula | C20H43NO2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | N-tert-butyl-3,3,6-trimethyl-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]heptan-1-amine |
| SMILES | CC(C)(CCNC(C)(C)C)CCC(C)(C)OCCOC(C)(C)C |
| InChI | InChI=1S/C20H43NO2/c1-17(2,3)21-14-13-19(7,8)11-12-20(9,10)23-16-15-22-18(4,5)6/h21H,11-16H2,1-10H3 |
| InChIKey | IOCGENQMXKVKOS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|