C26H47NO2S2 — CID 166654580
4-[5-(2-ethyl-1-sulfanylcyclohexyl)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-N-(3-hydroxysulfanylpropyl)butanamide (PubChem CID 166654580) has the molecular formula C26H47NO2S2 and a molecular weight of 469.80 g/mol. Its IUPAC name is 4-[5-(2-ethyl-1-sulfanylcyclohexyl)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-N-(3-hydroxysulfanylpropyl)butanamide.
| Compound Name | 4-[5-(2-ethyl-1-sulfanylcyclohexyl)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-N-(3-hydroxysulfanylpropyl)butanamide |
|---|---|
| PubChem CID | 166654580 |
| Molecular Formula | C26H47NO2S2 |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | 4-[5-(2-ethyl-1-sulfanylcyclohexyl)-4,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-N-(3-hydroxysulfanylpropyl)butanamide |
| SMILES | CCC1CCCCC1(S)C1CCC2(C)C(CCCC(=O)NCCCSO)CCC2C1C |
| InChI | InChI=1S/C26H47NO2S2/c1-4-20-9-5-6-15-26(20,30)23-14-16-25(3)21(12-13-22(25)19(23)2)10-7-11-24(28)27-17-8-18-31-29/h19-23,29-30H,4-18H2,1-3H3,(H,27,28) |
| InChIKey | XGPRLGKNQUTOTB-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|