C15H17F3O6S — CID 166661911
[7-(oxan-2-yloxy)-3,4-dihydro-2H-chromen-4-yl] trifluoromethanesulfonate (PubChem CID 166661911) has the molecular formula C15H17F3O6S and a molecular weight of 382.36 g/mol. Its IUPAC name is [7-(oxan-2-yloxy)-3,4-dihydro-2H-chromen-4-yl] trifluoromethanesulfonate.
| Compound Name | [7-(oxan-2-yloxy)-3,4-dihydro-2H-chromen-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166661911 |
| Molecular Formula | C15H17F3O6S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [7-(oxan-2-yloxy)-3,4-dihydro-2H-chromen-4-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1CCOc2cc(OC3CCCCO3)ccc21)C(F)(F)F |
| InChI | InChI=1S/C15H17F3O6S/c16-15(17,18)25(19,20)24-12-6-8-21-13-9-10(4-5-11(12)13)23-14-3-1-2-7-22-14/h4-5,9,12,14H,1-3,6-8H2 |
| InChIKey | DRBRVNFZGAXHJV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|