C7H13N3O — CID 166663902
N-[(Z)-2-amino-4-methyliminobut-2-enyl]acetamide (PubChem CID 166663902) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is N-[(Z)-2-amino-4-methyliminobut-2-enyl]acetamide.
| Compound Name | N-[(Z)-2-amino-4-methyliminobut-2-enyl]acetamide |
|---|---|
| PubChem CID | 166663902 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-[(Z)-2-amino-4-methyliminobut-2-enyl]acetamide |
| SMILES | C/N=C/C=C(\N)CNC(C)=O |
| InChI | InChI=1S/C7H13N3O/c1-6(11)10-5-7(8)3-4-9-2/h3-4H,5,8H2,1-2H3,(H,10,11)/b7-3-,9-4+ |
| InChIKey | AAHQIKJEAGLSTO-CITSBAIRSA-N |
| XLogP | -0.33 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|