C8H14N2O — CID 144511423
N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]acetamide;molecular hydrogen (PubChem CID 144511423) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]acetamide;molecular hydrogen.
| Compound Name | N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]acetamide;molecular hydrogen |
|---|---|
| PubChem CID | 144511423 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-[(2Z)-2-(methylideneamino)penta-2,4-dienyl]acetamide;molecular hydrogen |
| SMILES | C=C/C=C(/CNC(C)=O)N=C.[H][H] |
| InChI | InChI=1S/C8H12N2O.H2/c1-4-5-8(9-3)6-10-7(2)11;/h4-5H,1,3,6H2,2H3,(H,10,11);1H/b8-5-; |
| InChIKey | XNTYXFRBXKUVSD-HGKIGUAWSA-N |
| XLogP | 1.14 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|