C40H48ClNO5 — CID 166665556
tert-butyl (4S)-7-chloro-5'-[[(1R,2R)-2-[1-[(4-methoxyphenyl)methoxy]but-3-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate (PubChem CID 166665556) has the molecular formula C40H48ClNO5 and a molecular weight of 658.28 g/mol. Its IUPAC name is tert-butyl (4S)-7-chloro-5'-[[(1R,2R)-2-[1-[(4-methoxyphenyl)methoxy]but-3-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate.
| Compound Name | tert-butyl (4S)-7-chloro-5'-[[(1R,2R)-2-[1-[(4-methoxyphenyl)methoxy]but-3-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
|---|---|
| PubChem CID | 166665556 |
| Molecular Formula | C40H48ClNO5 |
| Molecular Weight | 658.28 g/mol |
| Exact Mass | 657.32 |
| IUPAC Name | tert-butyl (4S)-7-chloro-5'-[[(1R,2R)-2-[1-[(4-methoxyphenyl)methoxy]but-3-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
| SMILES | C=CCC(OCc1ccc(OC)cc1)[C@@H]1CC[C@H]1CN1C[C@@]2(CCCc3cc(Cl)ccc32)COc2ccc(C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C40H48ClNO5/c1-6-8-36(45-24-27-10-15-32(44-5)16-11-27)33-17-12-30(33)23-42-25-40(20-7-9-28-21-31(41)14-18-34(28)40)26-46-37-19-13-29(22-35(37)42)38(43)47-39(2,3)4/h6,10-11,13-16,18-19,21-22,30,33,36H,1,7-9,12,17,20,23-26H2,2-5H3/t30-,33+,36?,40-/m0/s1 |
| InChIKey | GELKPJQGOIBZSQ-CGIJFYNDSA-N |
| XLogP | 8.96 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.28 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|