C45H82N2O5 — CID 166667959
1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[[2-[ethyl(methyl)amino]acetyl]amino]henicosanedioate (PubChem CID 166667959) has the molecular formula C45H82N2O5 and a molecular weight of 731.16 g/mol. Its IUPAC name is 1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[[2-[ethyl(methyl)amino]acetyl]amino]henicosanedioate.
| Compound Name | 1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[[2-[ethyl(methyl)amino]acetyl]amino]henicosanedioate |
|---|---|
| PubChem CID | 166667959 |
| Molecular Formula | C45H82N2O5 |
| Molecular Weight | 731.16 g/mol |
| Exact Mass | 730.62 |
| IUPAC Name | 1-O-(3-butylhepta-4,5,6-trienyl) 21-O-(3-methylheptyl) 11-[[2-[ethyl(methyl)amino]acetyl]amino]henicosanedioate |
| SMILES | C=C=C=CC(CCCC)CCOC(=O)CCCCCCCCCC(CCCCCCCCCC(=O)OCCC(C)CCCC)NC(=O)CN(C)CC |
| InChI | InChI=1S/C45H82N2O5/c1-7-11-28-40(5)35-37-51-44(49)33-26-22-18-14-16-20-24-31-42(46-43(48)39-47(6)10-4)32-25-21-17-15-19-23-27-34-45(50)52-38-36-41(29-12-8-2)30-13-9-3/h29,40-42H,2,7,9-11,13-28,30-39H2,1,3-6H3,(H,46,48) |
| InChIKey | MNBVDAUAUXQMHW-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.16 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|