C51H93NO5 — CID 166667700
1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-[4-[methyl(propan-2-yl)amino]butoxy]henicosanedioate (PubChem CID 166667700) has the molecular formula C51H93NO5 and a molecular weight of 800.31 g/mol. Its IUPAC name is 1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-[4-[methyl(propan-2-yl)amino]butoxy]henicosanedioate.
| Compound Name | 1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-[4-[methyl(propan-2-yl)amino]butoxy]henicosanedioate |
|---|---|
| PubChem CID | 166667700 |
| Molecular Formula | C51H93NO5 |
| Molecular Weight | 800.31 g/mol |
| Exact Mass | 799.71 |
| IUPAC Name | 1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-[4-[methyl(propan-2-yl)amino]butoxy]henicosanedioate |
| SMILES | C=C=C=C=CC(CCCCC)CCOC(=O)CCCCCCCCCC(CCCCCCCCCC(=O)OCCC(C)CCCCC)OCCCCN(C)C(C)C |
| InChI | InChI=1S/C51H93NO5/c1-8-11-24-33-47(6)40-44-56-50(53)38-29-22-18-14-16-20-27-36-49(55-43-32-31-42-52(7)46(4)5)37-28-21-17-15-19-23-30-39-51(54)57-45-41-48(34-25-12-9-2)35-26-13-10-3/h34,46-49H,2,8,10-11,13-24,26-33,35-45H2,1,3-7H3 |
| InChIKey | REQLMKSXIGSDSP-UHFFFAOYSA-N |
| XLogP | 14.44 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.31 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|