C48H85NO6 — CID 166667851
[9-[5-(diethylamino)pentanoyloxy]-17-(3-methyloctanoyloxy)heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate (PubChem CID 166667851) has the molecular formula C48H85NO6 and a molecular weight of 772.21 g/mol. Its IUPAC name is [9-[5-(diethylamino)pentanoyloxy]-17-(3-methyloctanoyloxy)heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate.
| Compound Name | [9-[5-(diethylamino)pentanoyloxy]-17-(3-methyloctanoyloxy)heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate |
|---|---|
| PubChem CID | 166667851 |
| Molecular Formula | C48H85NO6 |
| Molecular Weight | 772.21 g/mol |
| Exact Mass | 771.64 |
| IUPAC Name | [9-[5-(diethylamino)pentanoyloxy]-17-(3-methyloctanoyloxy)heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate |
| SMILES | C=C=C=C=CC(CCCCC)CC(=O)OCCCCCCCCC(CCCCCCCCOC(=O)CC(C)CCCCC)OC(=O)CCCCN(CC)CC |
| InChI | InChI=1S/C48H85NO6/c1-7-12-23-32-43(6)41-47(51)53-39-30-21-17-15-19-26-35-45(55-46(50)37-28-29-38-49(10-4)11-5)36-27-20-16-18-22-31-40-54-48(52)42-44(33-24-13-8-2)34-25-14-9-3/h33,43-45H,2,7,9-12,14-23,25-32,34-42H2,1,3-6H3 |
| InChIKey | YYDPCGSERNLWCC-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.21 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|