C44H79NO5 — CID 166667669
[9-[3-(dimethylamino)propoxy]-17-(3-methyloctanoyloxy)heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate (PubChem CID 166667669) has the molecular formula C44H79NO5 and a molecular weight of 702.12 g/mol. Its IUPAC name is [9-[3-(dimethylamino)propoxy]-17-(3-methyloctanoyloxy)heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate.
| Compound Name | [9-[3-(dimethylamino)propoxy]-17-(3-methyloctanoyloxy)heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate |
|---|---|
| PubChem CID | 166667669 |
| Molecular Formula | C44H79NO5 |
| Molecular Weight | 702.12 g/mol |
| Exact Mass | 701.60 |
| IUPAC Name | [9-[3-(dimethylamino)propoxy]-17-(3-methyloctanoyloxy)heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate |
| SMILES | C=C=C=C=CC(CCCCC)CC(=O)OCCCCCCCCC(CCCCCCCCOC(=O)CC(C)CCCCC)OCCCN(C)C |
| InChI | InChI=1S/C44H79NO5/c1-7-10-21-29-40(4)38-43(46)49-35-26-19-15-13-17-24-32-42(48-37-28-34-45(5)6)33-25-18-14-16-20-27-36-50-44(47)39-41(30-22-11-8-2)31-23-12-9-3/h30,40-42H,2,7,9-10,12-21,23-29,31-39H2,1,3-6H3 |
| InChIKey | YGJFZOYPCAJNGV-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.12 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|