C45H80N2O4 — CID 166667844
[17-(3-methyloctanoyloxy)-9-[(4-methylpiperazin-1-yl)methyl]heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate (PubChem CID 166667844) has the molecular formula C45H80N2O4 and a molecular weight of 713.14 g/mol. Its IUPAC name is [17-(3-methyloctanoyloxy)-9-[(4-methylpiperazin-1-yl)methyl]heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate.
| Compound Name | [17-(3-methyloctanoyloxy)-9-[(4-methylpiperazin-1-yl)methyl]heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate |
|---|---|
| PubChem CID | 166667844 |
| Molecular Formula | C45H80N2O4 |
| Molecular Weight | 713.14 g/mol |
| Exact Mass | 712.61 |
| IUPAC Name | [17-(3-methyloctanoyloxy)-9-[(4-methylpiperazin-1-yl)methyl]heptadecyl] 3-pentylocta-4,5,6,7-tetraenoate |
| SMILES | C=C=C=C=CC(CCCCC)CC(=O)OCCCCCCCCC(CCCCCCCCOC(=O)CC(C)CCCCC)CN1CCN(C)CC1 |
| InChI | InChI=1S/C45H80N2O4/c1-6-9-20-27-41(4)38-44(48)50-36-25-18-14-12-16-23-30-43(40-47-34-32-46(5)33-35-47)31-24-17-13-15-19-26-37-51-45(49)39-42(28-21-10-7-2)29-22-11-8-3/h28,41-43H,2,6,8-9,11-20,22-27,29-40H2,1,3-5H3 |
| InChIKey | QBLCKJZEEFNQOQ-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.14 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|