C51H89NO7 — CID 166667906
1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-(4-morpholin-4-ylbutanoyloxy)henicosanedioate (PubChem CID 166667906) has the molecular formula C51H89NO7 and a molecular weight of 828.27 g/mol. Its IUPAC name is 1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-(4-morpholin-4-ylbutanoyloxy)henicosanedioate.
| Compound Name | 1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-(4-morpholin-4-ylbutanoyloxy)henicosanedioate |
|---|---|
| PubChem CID | 166667906 |
| Molecular Formula | C51H89NO7 |
| Molecular Weight | 828.27 g/mol |
| Exact Mass | 827.66 |
| IUPAC Name | 1-O-(3-methyloctyl) 21-O-(3-pentylocta-4,5,6,7-tetraenyl) 11-(4-morpholin-4-ylbutanoyloxy)henicosanedioate |
| SMILES | C=C=C=C=CC(CCCCC)CCOC(=O)CCCCCCCCCC(CCCCCCCCCC(=O)OCCC(C)CCCCC)OC(=O)CCCN1CCOCC1 |
| InChI | InChI=1S/C51H89NO7/c1-5-8-21-29-46(4)37-42-57-49(53)34-26-19-15-11-13-17-24-32-48(59-51(55)36-28-39-52-40-44-56-45-41-52)33-25-18-14-12-16-20-27-35-50(54)58-43-38-47(30-22-9-6-2)31-23-10-7-3/h30,46-48H,2,5,7-8,10-21,23-29,31-45H2,1,3-4H3 |
| InChIKey | JYHOTGJCMMIOBA-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.27 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|