C20H27N5O3S2 — CID 166669331
1,3-diamino-1-[2-[[N-(3,4-dimethoxyphenyl)-C-methylsulfanylcarbonimidoyl]sulfanylmethyl]-3-methylphenyl]-3-methylurea (PubChem CID 166669331) has the molecular formula C20H27N5O3S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[[N-(3,4-dimethoxyphenyl)-C-methylsulfanylcarbonimidoyl]sulfanylmethyl]-3-methylphenyl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[2-[[N-(3,4-dimethoxyphenyl)-C-methylsulfanylcarbonimidoyl]sulfanylmethyl]-3-methylphenyl]-3-methylurea |
|---|---|
| PubChem CID | 166669331 |
| Molecular Formula | C20H27N5O3S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 1,3-diamino-1-[2-[[N-(3,4-dimethoxyphenyl)-C-methylsulfanylcarbonimidoyl]sulfanylmethyl]-3-methylphenyl]-3-methylurea |
| SMILES | COc1ccc(/N=C(\SC)SCc2c(C)cccc2N(N)C(=O)N(C)N)cc1OC |
| InChI | InChI=1S/C20H27N5O3S2/c1-13-7-6-8-16(25(22)20(26)24(2)21)15(13)12-30-19(29-5)23-14-9-10-17(27-3)18(11-14)28-4/h6-11H,12,21-22H2,1-5H3/b23-19+ |
| InChIKey | UVLCVLIZIMQQMR-FCDQGJHFSA-N |
| XLogP | 3.90 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|