About 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate
2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate (PubChem CID 166669406) has the molecular formula C19H25N3O2
and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate.
Molecular Properties
| Compound Name | 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate |
| PubChem CID | 166669406 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate |
| SMILES | CC(=NOCc1c(C)cccc1N(C)N)OCCc1ccccc1 |
| InChI | InChI=1S/C19H25N3O2/c1-15-8-7-11-19(22(3)20)18(15)14-24-21-16(2)23-13-12-17-9-5-4-6-10-17/h4-11H,12-14,20H2,1-3H3 |
| InChIKey | PYYPRLQXKWYNGT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate?
The IUPAC name of 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate (CID 166669406) is 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate.
What is the SMILES notation for 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate?
The canonical SMILES for 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate is CC(=NOCc1c(C)cccc1N(C)N)OCCc1ccccc1.
What is the InChIKey of 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate?
The InChIKey is PYYPRLQXKWYNGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O2/c1-15-8-7-11-19(22(3)20)18(15)14-24-21-16(2)23-13-12-17-9-5-4-6-10-17/h4-11H,12-14,20H2,1-3H3.
What are the key properties of 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate?
2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate has a molecular weight of 327.43 g/mol, XLogP of 3.41, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]ethanimidate is sourced from PubChem (CID 166669406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).