C13H15F3N2 — CID 166672076
N-[(Z)-propylideneamino]-N-[[4-(trifluoromethyl)phenyl]methyl]ethenamine (PubChem CID 166672076) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is N-[(Z)-propylideneamino]-N-[[4-(trifluoromethyl)phenyl]methyl]ethenamine.
| Compound Name | N-[(Z)-propylideneamino]-N-[[4-(trifluoromethyl)phenyl]methyl]ethenamine |
|---|---|
| PubChem CID | 166672076 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-[(Z)-propylideneamino]-N-[[4-(trifluoromethyl)phenyl]methyl]ethenamine |
| SMILES | C=CN(Cc1ccc(C(F)(F)F)cc1)/N=C\CC |
| InChI | InChI=1S/C13H15F3N2/c1-3-9-17-18(4-2)10-11-5-7-12(8-6-11)13(14,15)16/h4-9H,2-3,10H2,1H3/b17-9- |
| InChIKey | LYJVAKZFGBQTIW-MFOYZWKCSA-N |
| XLogP | 4.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|