C26H37NO5 — CID 166673279
3-O-(2-methoxyethyl) 5-O-propan-2-yl 4-(4-butylphenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 166673279) has the molecular formula C26H37NO5 and a molecular weight of 443.58 g/mol. Its IUPAC name is 3-O-(2-methoxyethyl) 5-O-propan-2-yl 4-(4-butylphenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(2-methoxyethyl) 5-O-propan-2-yl 4-(4-butylphenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 166673279 |
| Molecular Formula | C26H37NO5 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 3-O-(2-methoxyethyl) 5-O-propan-2-yl 4-(4-butylphenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCCCc1ccc(C2C(C(=O)OCCOC)=C(C)N(C)C(C)=C2C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C26H37NO5/c1-8-9-10-20-11-13-21(14-12-20)24-22(25(28)31-16-15-30-7)18(4)27(6)19(5)23(24)26(29)32-17(2)3/h11-14,17,24H,8-10,15-16H2,1-7H3 |
| InChIKey | YBLPQJCPRQLRLT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|