C22H38N2 — CID 166675883
[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-tetradecan-7-yldiazene (PubChem CID 166675883) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-tetradecan-7-yldiazene.
| Compound Name | [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-tetradecan-7-yldiazene |
|---|---|
| PubChem CID | 166675883 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-tetradecan-7-yldiazene |
| SMILES | C=C/C=C\C(=C/C=C)\N=N\C(CCCCCC)CCCCCCC |
| InChI | InChI=1S/C22H38N2/c1-5-9-12-14-16-20-22(19-15-13-10-6-2)24-23-21(17-8-4)18-11-7-3/h7-8,11,17-18,22H,3-6,9-10,12-16,19-20H2,1-2H3/b18-11-,21-17+,24-23+ |
| InChIKey | KYAOPJQVBPXDEK-YWRPBEEESA-N |
| XLogP | 7.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|