C11H17N4NaO7S — CID 166682389
sodium;2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;cyanate (PubChem CID 166682389) has the molecular formula C11H17N4NaO7S and a molecular weight of 372.34 g/mol. Its IUPAC name is sodium;2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;cyanate.
| Compound Name | sodium;2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;cyanate |
|---|---|
| PubChem CID | 166682389 |
| Molecular Formula | C11H17N4NaO7S |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | sodium;2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;cyanate |
| SMILES | N#C[O-].NC(CCC(=O)NC(CS)C(=O)NCC(=O)O)C(=O)O.[Na+] |
| InChI | InChI=1S/C10H17N3O6S.CHNO.Na/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16;2-1-3;/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19);3H;/q;;+1/p-1 |
| InChIKey | XRUKRQZFJHDOJE-UHFFFAOYSA-M |
| XLogP | -6.37 |
| TPSA | 205.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | -6.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|