C6H7BrClNS — CID 166684447
[(1E,3Z)-2-bromo-4-(methylideneamino)penta-1,3-dienyl] thiohypochlorite (PubChem CID 166684447) has the molecular formula C6H7BrClNS and a molecular weight of 240.55 g/mol. Its IUPAC name is [(1E,3Z)-2-bromo-4-(methylideneamino)penta-1,3-dienyl] thiohypochlorite.
| Compound Name | [(1E,3Z)-2-bromo-4-(methylideneamino)penta-1,3-dienyl] thiohypochlorite |
|---|---|
| PubChem CID | 166684447 |
| Molecular Formula | C6H7BrClNS |
| Molecular Weight | 240.55 g/mol |
| Exact Mass | 238.92 |
| IUPAC Name | [(1E,3Z)-2-bromo-4-(methylideneamino)penta-1,3-dienyl] thiohypochlorite |
| SMILES | C=N/C(C)=C\C(Br)=C/SCl |
| InChI | InChI=1S/C6H7BrClNS/c1-5(9-2)3-6(7)4-10-8/h3-4H,2H2,1H3/b5-3-,6-4+ |
| InChIKey | PJDANYUIBANFKZ-CIIODKQPSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|