About 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole
3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole (PubChem CID 166687115) has the molecular formula C21H22F3N
and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole.
Molecular Properties
| Compound Name | 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole |
| PubChem CID | 166687115 |
| Molecular Formula | C21H22F3N |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole |
| SMILES | CC(C)CC(C)Cc1c(-c2ccc(F)cc2)[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C21H22F3N/c1-12(2)8-13(3)9-17-18-10-16(23)11-19(24)21(18)25-20(17)14-4-6-15(22)7-5-14/h4-7,10-13,25H,8-9H2,1-3H3 |
| InChIKey | KAHLYTXZJTZFIU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The IUPAC name of 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole (CID 166687115) is 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole.
What is the SMILES notation for 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The canonical SMILES for 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole is CC(C)CC(C)Cc1c(-c2ccc(F)cc2)[nH]c2c(F)cc(F)cc12.
What is the InChIKey of 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
The InChIKey is KAHLYTXZJTZFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22F3N/c1-12(2)8-13(3)9-17-18-10-16(23)11-19(24)21(18)25-20(17)14-4-6-15(22)7-5-14/h4-7,10-13,25H,8-9H2,1-3H3.
What are the key properties of 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole?
3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole has a molecular weight of 345.41 g/mol, XLogP of 6.48, 5 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole is sourced from PubChem (CID 166687115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).