C21H22F3N — CID 166687115
3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole (PubChem CID 166687115) has the molecular formula C21H22F3N and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole.
| Compound Name | 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole |
|---|---|
| PubChem CID | 166687115 |
| Molecular Formula | C21H22F3N |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-(2,4-dimethylpentyl)-5,7-difluoro-2-(4-fluorophenyl)-1H-indole |
| SMILES | CC(C)CC(C)Cc1c(-c2ccc(F)cc2)[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C21H22F3N/c1-12(2)8-13(3)9-17-18-10-16(23)11-19(24)21(18)25-20(17)14-4-6-15(22)7-5-14/h4-7,10-13,25H,8-9H2,1-3H3 |
| InChIKey | KAHLYTXZJTZFIU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |