C18H14F3NO2 — CID 175850702
2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]butanoic acid (PubChem CID 175850702) has the molecular formula C18H14F3NO2 and a molecular weight of 333.31 g/mol. Its IUPAC name is 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]butanoic acid.
| Compound Name | 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 175850702 |
| Molecular Formula | C18H14F3NO2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]butanoic acid |
| SMILES | CCC(C(=O)O)c1c(-c2ccc(F)cc2)[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C18H14F3NO2/c1-2-12(18(23)24)15-13-7-11(20)8-14(21)17(13)22-16(15)9-3-5-10(19)6-4-9/h3-8,12,22H,2H2,1H3,(H,23,24) |
| InChIKey | ZZMOAJMIYRYJKX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |