C19H17F3N2O — CID 175850685
2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-methylbutanamide (PubChem CID 175850685) has the molecular formula C19H17F3N2O and a molecular weight of 346.35 g/mol. Its IUPAC name is 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-methylbutanamide.
| Compound Name | 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 175850685 |
| Molecular Formula | C19H17F3N2O |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-N-methylbutanamide |
| SMILES | CCC(C(=O)NC)c1c(-c2ccc(F)cc2)[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C19H17F3N2O/c1-3-13(19(25)23-2)16-14-8-12(21)9-15(22)18(14)24-17(16)10-4-6-11(20)7-5-10/h4-9,13,24H,3H2,1-2H3,(H,23,25) |
| InChIKey | SSNMTRGBSYWIFF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |