C15H10BF2N3O — CID 172606686
CID 172606686 (PubChem CID 172606686) has the molecular formula C15H10BF2N3O and a molecular weight of 297.07 g/mol.
| Compound Name | CID 172606686 |
|---|---|
| PubChem CID | 172606686 |
| Molecular Formula | C15H10BF2N3O |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2[nH]c3c(F)cc(F)cc3c2C(=O)NN)cc1 |
| InChI | InChI=1S/C15H10BF2N3O/c16-8-3-1-7(2-4-8)13-12(15(22)21-19)10-5-9(17)6-11(18)14(10)20-13/h1-6,20H,19H2,(H,21,22) |
| InChIKey | GPTZPSQEKGLSPQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|