C16H10BF2NO2 — CID 172606539
CID 172606539 (PubChem CID 172606539) has the molecular formula C16H10BF2NO2 and a molecular weight of 297.07 g/mol.
| Compound Name | CID 172606539 |
|---|---|
| PubChem CID | 172606539 |
| Molecular Formula | C16H10BF2NO2 |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2[nH]c3c(F)cc(F)cc3c2C(=O)OC)cc1 |
| InChI | InChI=1S/C16H10BF2NO2/c1-22-16(21)13-11-6-10(18)7-12(19)15(11)20-14(13)8-2-4-9(17)5-3-8/h2-7,20H,1H3 |
| InChIKey | OHDQFPVRZZQFRZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|