C19H16F3N5O2 — CID 172606728
[N'-[2-(methylamino)-2-oxoethyl]carbamimidoyl] 5,7-difluoro-2-(4-fluorophenyl)-1H-indole-3-carboximidate (PubChem CID 172606728) has the molecular formula C19H16F3N5O2 and a molecular weight of 403.36 g/mol. Its IUPAC name is [N'-[2-(methylamino)-2-oxoethyl]carbamimidoyl] 5,7-difluoro-2-(4-fluorophenyl)-1H-indole-3-carboximidate.
| Compound Name | [N'-[2-(methylamino)-2-oxoethyl]carbamimidoyl] 5,7-difluoro-2-(4-fluorophenyl)-1H-indole-3-carboximidate |
|---|---|
| PubChem CID | 172606728 |
| Molecular Formula | C19H16F3N5O2 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [N'-[2-(methylamino)-2-oxoethyl]carbamimidoyl] 5,7-difluoro-2-(4-fluorophenyl)-1H-indole-3-carboximidate |
| SMILES | [H]/N=C(\O/C(N)=N/CC(=O)NC)c1c(-c2ccc(F)cc2)[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C19H16F3N5O2/c1-25-14(28)8-26-19(24)29-18(23)15-12-6-11(21)7-13(22)17(12)27-16(15)9-2-4-10(20)5-3-9/h2-7,23,27H,8H2,1H3,(H2,24,26)(H,25,28)/b23-18- |
| InChIKey | IVDBBTSVVYOAQK-NKFKGCMQSA-N |
| XLogP | 2.65 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|