About azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate
azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate (PubChem CID 166691236) has the molecular formula C16H21NO3
and a molecular weight of 275.35 g/mol. Its IUPAC name is azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate.
Molecular Properties
| Compound Name | azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate |
| PubChem CID | 166691236 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate |
| SMILES | CC(C)c1ccccc1C(CC=O)C(=O)ON1CCC1 |
| InChI | InChI=1S/C16H21NO3/c1-12(2)13-6-3-4-7-14(13)15(8-11-18)16(19)20-17-9-5-10-17/h3-4,6-7,11-12,15H,5,8-10H2,1-2H3 |
| InChIKey | CAKDGUGAEBWTDT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate?
The IUPAC name of azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate (CID 166691236) is azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate.
What is the SMILES notation for azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate?
The canonical SMILES for azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate is CC(C)c1ccccc1C(CC=O)C(=O)ON1CCC1.
What is the InChIKey of azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate?
The InChIKey is CAKDGUGAEBWTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3/c1-12(2)13-6-3-4-7-14(13)15(8-11-18)16(19)20-17-9-5-10-17/h3-4,6-7,11-12,15H,5,8-10H2,1-2H3.
What are the key properties of azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate?
azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate has a molecular weight of 275.35 g/mol, XLogP of 2.65, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-1-yl 4-oxo-2-(2-propan-2-ylphenyl)butanoate is sourced from PubChem (CID 166691236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).