C14H31N3O3 — CID 166694904
N-methyl-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]-2-[methyl(propan-2-yl)amino]acetamide (PubChem CID 166694904) has the molecular formula C14H31N3O3 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-methyl-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]-2-[methyl(propan-2-yl)amino]acetamide.
| Compound Name | N-methyl-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]-2-[methyl(propan-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 166694904 |
| Molecular Formula | C14H31N3O3 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | N-methyl-N-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethyl]-2-[methyl(propan-2-yl)amino]acetamide |
| SMILES | CNCCOCCOCCN(C)C(=O)CN(C)C(C)C |
| InChI | InChI=1S/C14H31N3O3/c1-13(2)17(5)12-14(18)16(4)7-9-20-11-10-19-8-6-15-3/h13,15H,6-12H2,1-5H3 |
| InChIKey | CNRPWIKLFAOVNN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|