C11H24N2O2 — CID 144736647
3-methyl-2-[methyl-[2-[2-(methylamino)ethoxy]ethyl]amino]butanal (PubChem CID 144736647) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-methyl-2-[methyl-[2-[2-(methylamino)ethoxy]ethyl]amino]butanal.
| Compound Name | 3-methyl-2-[methyl-[2-[2-(methylamino)ethoxy]ethyl]amino]butanal |
|---|---|
| PubChem CID | 144736647 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-methyl-2-[methyl-[2-[2-(methylamino)ethoxy]ethyl]amino]butanal |
| SMILES | CNCCOCCN(C)C(C=O)C(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-10(2)11(9-14)13(4)6-8-15-7-5-12-3/h9-12H,5-8H2,1-4H3 |
| InChIKey | KGLQNIZOBWYRJF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|