C21H41N3O7 — CID 173485744
(2S)-2-amino-6-[3-[2-[2-[2-[methyl-[(2S)-3-methyl-1-oxobutan-2-yl]amino]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid (PubChem CID 173485744) has the molecular formula C21H41N3O7 and a molecular weight of 447.57 g/mol. Its IUPAC name is (2S)-2-amino-6-[3-[2-[2-[2-[methyl-[(2S)-3-methyl-1-oxobutan-2-yl]amino]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[3-[2-[2-[2-[methyl-[(2S)-3-methyl-1-oxobutan-2-yl]amino]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 173485744 |
| Molecular Formula | C21H41N3O7 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | (2S)-2-amino-6-[3-[2-[2-[2-[methyl-[(2S)-3-methyl-1-oxobutan-2-yl]amino]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid |
| SMILES | CC(C)[C@@H](C=O)N(C)CCOCCOCCOCCC(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C21H41N3O7/c1-17(2)19(16-25)24(3)9-11-30-13-15-31-14-12-29-10-7-20(26)23-8-5-4-6-18(22)21(27)28/h16-19H,4-15,22H2,1-3H3,(H,23,26)(H,27,28)/t18-,19+/m0/s1 |
| InChIKey | FPPAWRSHMCZXGZ-RBUKOAKNSA-N |
| XLogP | 0.28 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|