C12H17F4N — CID 166698514
3,3,4,4-tetrafluoro-1-[(E)-5-methyl-4-methylidenehex-2-enyl]pyrrolidine (PubChem CID 166698514) has the molecular formula C12H17F4N and a molecular weight of 251.27 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1-[(E)-5-methyl-4-methylidenehex-2-enyl]pyrrolidine.
| Compound Name | 3,3,4,4-tetrafluoro-1-[(E)-5-methyl-4-methylidenehex-2-enyl]pyrrolidine |
|---|---|
| PubChem CID | 166698514 |
| Molecular Formula | C12H17F4N |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1-[(E)-5-methyl-4-methylidenehex-2-enyl]pyrrolidine |
| SMILES | C=C(/C=C/CN1CC(F)(F)C(F)(F)C1)C(C)C |
| InChI | InChI=1S/C12H17F4N/c1-9(2)10(3)5-4-6-17-7-11(13,14)12(15,16)8-17/h4-5,9H,3,6-8H2,1-2H3/b5-4+ |
| InChIKey | OOEJXPMCZZONDC-SNAWJCMRSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|