C16H24F3N — CID 138519067
3-methyl-N-prop-2-enyl-N-[[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]butan-1-amine (PubChem CID 138519067) has the molecular formula C16H24F3N and a molecular weight of 287.37 g/mol. Its IUPAC name is 3-methyl-N-prop-2-enyl-N-[[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]butan-1-amine.
| Compound Name | 3-methyl-N-prop-2-enyl-N-[[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 138519067 |
| Molecular Formula | C16H24F3N |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 3-methyl-N-prop-2-enyl-N-[[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]methyl]butan-1-amine |
| SMILES | C=CCN(CCC(C)C)CC1=CCC(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C16H24F3N/c1-4-10-20(11-9-13(2)3)12-14-5-7-15(8-6-14)16(17,18)19/h4-7,13,15H,1,8-12H2,2-3H3 |
| InChIKey | DEDHJHGTMLJUSP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|