C13H19F2N — CID 142482447
3,3-difluoro-1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine (PubChem CID 142482447) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is 3,3-difluoro-1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine.
| Compound Name | 3,3-difluoro-1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 142482447 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 3,3-difluoro-1-[(3E)-4-propan-2-ylhexa-1,3,5-trien-3-yl]pyrrolidine |
| SMILES | C=C/C(=C(\C=C)N1CCC(F)(F)C1)C(C)C |
| InChI | InChI=1S/C13H19F2N/c1-5-11(10(3)4)12(6-2)16-8-7-13(14,15)9-16/h5-6,10H,1-2,7-9H2,3-4H3/b12-11- |
| InChIKey | AFNHKYSFCAZMDG-QXMHVHEDSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|