C23H25F4N3O2S — CID 166706554
4-(diethylaminosulfanyl)-2-[4-[5-fluoro-2-(trifluoromethyl)benzoyl]piperazin-1-yl]benzaldehyde (PubChem CID 166706554) has the molecular formula C23H25F4N3O2S and a molecular weight of 483.53 g/mol. Its IUPAC name is 4-(diethylaminosulfanyl)-2-[4-[5-fluoro-2-(trifluoromethyl)benzoyl]piperazin-1-yl]benzaldehyde.
| Compound Name | 4-(diethylaminosulfanyl)-2-[4-[5-fluoro-2-(trifluoromethyl)benzoyl]piperazin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 166706554 |
| Molecular Formula | C23H25F4N3O2S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 4-(diethylaminosulfanyl)-2-[4-[5-fluoro-2-(trifluoromethyl)benzoyl]piperazin-1-yl]benzaldehyde |
| SMILES | CCN(CC)Sc1ccc(C=O)c(N2CCN(C(=O)c3cc(F)ccc3C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C23H25F4N3O2S/c1-3-30(4-2)33-18-7-5-16(15-31)21(14-18)28-9-11-29(12-10-28)22(32)19-13-17(24)6-8-20(19)23(25,26)27/h5-8,13-15H,3-4,9-12H2,1-2H3 |
| InChIKey | ORTITDZOPASIAE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|