C24H26F4N4O2 — CID 91431980
3-[4-[5-fluoro-2-(trifluoromethyl)benzoyl]piperazin-1-yl]-6-pentyl-5H-pyrrolo[3,4-b]pyridin-7-one (PubChem CID 91431980) has the molecular formula C24H26F4N4O2 and a molecular weight of 478.49 g/mol. Its IUPAC name is 3-[4-[5-fluoro-2-(trifluoromethyl)benzoyl]piperazin-1-yl]-6-pentyl-5H-pyrrolo[3,4-b]pyridin-7-one.
| Compound Name | 3-[4-[5-fluoro-2-(trifluoromethyl)benzoyl]piperazin-1-yl]-6-pentyl-5H-pyrrolo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 91431980 |
| Molecular Formula | C24H26F4N4O2 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 3-[4-[5-fluoro-2-(trifluoromethyl)benzoyl]piperazin-1-yl]-6-pentyl-5H-pyrrolo[3,4-b]pyridin-7-one |
| SMILES | CCCCCN1Cc2cc(N3CCN(C(=O)c4cc(F)ccc4C(F)(F)F)CC3)cnc2C1=O |
| InChI | InChI=1S/C24H26F4N4O2/c1-2-3-4-7-32-15-16-12-18(14-29-21(16)23(32)34)30-8-10-31(11-9-30)22(33)19-13-17(25)5-6-20(19)24(26,27)28/h5-6,12-14H,2-4,7-11,15H2,1H3 |
| InChIKey | LOSIGNUEFPOPEE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|