C20H15ClF4N4O2 — CID 166706798
5-chloro-N-[2-[3,5-difluoro-4-[(E)-methoxyiminomethyl]phenyl]phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide (PubChem CID 166706798) has the molecular formula C20H15ClF4N4O2 and a molecular weight of 454.81 g/mol. Its IUPAC name is 5-chloro-N-[2-[3,5-difluoro-4-[(E)-methoxyiminomethyl]phenyl]phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-[2-[3,5-difluoro-4-[(E)-methoxyiminomethyl]phenyl]phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166706798 |
| Molecular Formula | C20H15ClF4N4O2 |
| Molecular Weight | 454.81 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 5-chloro-N-[2-[3,5-difluoro-4-[(E)-methoxyiminomethyl]phenyl]phenyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
| SMILES | CO/N=C/c1c(F)cc(-c2ccccc2NC(=O)c2c(C(F)F)nn(C)c2Cl)cc1F |
| InChI | InChI=1S/C20H15ClF4N4O2/c1-29-18(21)16(17(28-29)19(24)25)20(30)27-15-6-4-3-5-11(15)10-7-13(22)12(9-26-31-2)14(23)8-10/h3-9,19H,1-2H3,(H,27,30)/b26-9+ |
| InChIKey | RMKUBDFOLILVFV-JQAMDZJQSA-N |
| XLogP | 5.19 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.81 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|